C9H14F3NO5 — CID 107832677
2-hydroxy-4-[3-(2,2,2-trifluoroethoxy)propanoylamino]butanoic acid (PubChem CID 107832677) has the molecular formula C9H14F3NO5 and a molecular weight of 273.21 g/mol. Its IUPAC name is 2-hydroxy-4-[3-(2,2,2-trifluoroethoxy)propanoylamino]butanoic acid.
| Compound Name | 2-hydroxy-4-[3-(2,2,2-trifluoroethoxy)propanoylamino]butanoic acid |
|---|---|
| PubChem CID | 107832677 |
| Molecular Formula | C9H14F3NO5 |
| Molecular Weight | 273.21 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 2-hydroxy-4-[3-(2,2,2-trifluoroethoxy)propanoylamino]butanoic acid |
| SMILES | O=C(CCOCC(F)(F)F)NCCC(O)C(=O)O |
| InChI | InChI=1S/C9H14F3NO5/c10-9(11,12)5-18-4-2-7(15)13-3-1-6(14)8(16)17/h6,14H,1-5H2,(H,13,15)(H,16,17) |
| InChIKey | QZXCTSPELLSPMK-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.21 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|