C13H22F3NO4 — CID 65284068
4,4-dimethyl-6-[3-(2,2,2-trifluoroethoxy)propanoylamino]hexanoic acid (PubChem CID 65284068) has the molecular formula C13H22F3NO4 and a molecular weight of 313.32 g/mol. Its IUPAC name is 4,4-dimethyl-6-[3-(2,2,2-trifluoroethoxy)propanoylamino]hexanoic acid.
| Compound Name | 4,4-dimethyl-6-[3-(2,2,2-trifluoroethoxy)propanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 65284068 |
| Molecular Formula | C13H22F3NO4 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 4,4-dimethyl-6-[3-(2,2,2-trifluoroethoxy)propanoylamino]hexanoic acid |
| SMILES | CC(C)(CCNC(=O)CCOCC(F)(F)F)CCC(=O)O |
| InChI | InChI=1S/C13H22F3NO4/c1-12(2,5-3-11(19)20)6-7-17-10(18)4-8-21-9-13(14,15)16/h3-9H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | QYMNPEBOSPZKMA-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|