C11H19F3N2O4 — CID 63832295
4-methyl-4-[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]pentanoic acid (PubChem CID 63832295) has the molecular formula C11H19F3N2O4 and a molecular weight of 300.28 g/mol. Its IUPAC name is 4-methyl-4-[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]pentanoic acid.
| Compound Name | 4-methyl-4-[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]pentanoic acid |
|---|---|
| PubChem CID | 63832295 |
| Molecular Formula | C11H19F3N2O4 |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 4-methyl-4-[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]pentanoic acid |
| SMILES | CC(C)(CCC(=O)O)NC(=O)NCCOCC(F)(F)F |
| InChI | InChI=1S/C11H19F3N2O4/c1-10(2,4-3-8(17)18)16-9(19)15-5-6-20-7-11(12,13)14/h3-7H2,1-2H3,(H,17,18)(H2,15,16,19) |
| InChIKey | WKZIBHLTYKJAOU-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|