C12H22F3NO3 — CID 103899562
N-(5-hydroxy-2,2-dimethylpentyl)-3-(2,2,2-trifluoroethoxy)propanamide (PubChem CID 103899562) has the molecular formula C12H22F3NO3 and a molecular weight of 285.31 g/mol. Its IUPAC name is N-(5-hydroxy-2,2-dimethylpentyl)-3-(2,2,2-trifluoroethoxy)propanamide.
| Compound Name | N-(5-hydroxy-2,2-dimethylpentyl)-3-(2,2,2-trifluoroethoxy)propanamide |
|---|---|
| PubChem CID | 103899562 |
| Molecular Formula | C12H22F3NO3 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | N-(5-hydroxy-2,2-dimethylpentyl)-3-(2,2,2-trifluoroethoxy)propanamide |
| SMILES | CC(C)(CCCO)CNC(=O)CCOCC(F)(F)F |
| InChI | InChI=1S/C12H22F3NO3/c1-11(2,5-3-6-17)8-16-10(18)4-7-19-9-12(13,14)15/h17H,3-9H2,1-2H3,(H,16,18) |
| InChIKey | XCRDZBUCGJRILY-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|