C12H21BrF3NO2 — CID 107156756
N-(2-bromo-4,4-dimethylpentyl)-3-(2,2,2-trifluoroethoxy)propanamide (PubChem CID 107156756) has the molecular formula C12H21BrF3NO2 and a molecular weight of 348.20 g/mol. Its IUPAC name is N-(2-bromo-4,4-dimethylpentyl)-3-(2,2,2-trifluoroethoxy)propanamide.
| Compound Name | N-(2-bromo-4,4-dimethylpentyl)-3-(2,2,2-trifluoroethoxy)propanamide |
|---|---|
| PubChem CID | 107156756 |
| Molecular Formula | C12H21BrF3NO2 |
| Molecular Weight | 348.20 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | N-(2-bromo-4,4-dimethylpentyl)-3-(2,2,2-trifluoroethoxy)propanamide |
| SMILES | CC(C)(C)CC(Br)CNC(=O)CCOCC(F)(F)F |
| InChI | InChI=1S/C12H21BrF3NO2/c1-11(2,3)6-9(13)7-17-10(18)4-5-19-8-12(14,15)16/h9H,4-8H2,1-3H3,(H,17,18) |
| InChIKey | NUYJEOMQETYAAT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.20 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|