C10H17BrF3NO2 — CID 103212739
N-(2-bromopentyl)-3-(2,2,2-trifluoroethoxy)propanamide (PubChem CID 103212739) has the molecular formula C10H17BrF3NO2 and a molecular weight of 320.15 g/mol. Its IUPAC name is N-(2-bromopentyl)-3-(2,2,2-trifluoroethoxy)propanamide.
| Compound Name | N-(2-bromopentyl)-3-(2,2,2-trifluoroethoxy)propanamide |
|---|---|
| PubChem CID | 103212739 |
| Molecular Formula | C10H17BrF3NO2 |
| Molecular Weight | 320.15 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | N-(2-bromopentyl)-3-(2,2,2-trifluoroethoxy)propanamide |
| SMILES | CCCC(Br)CNC(=O)CCOCC(F)(F)F |
| InChI | InChI=1S/C10H17BrF3NO2/c1-2-3-8(11)6-15-9(16)4-5-17-7-10(12,13)14/h8H,2-7H2,1H3,(H,15,16) |
| InChIKey | NNRIRVVJBZPQDP-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.15 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|