C10H18BrF2NO2 — CID 103212738
N-(2-bromopentyl)-3-(2,2-difluoroethoxy)propanamide (PubChem CID 103212738) has the molecular formula C10H18BrF2NO2 and a molecular weight of 302.16 g/mol. Its IUPAC name is N-(2-bromopentyl)-3-(2,2-difluoroethoxy)propanamide.
| Compound Name | N-(2-bromopentyl)-3-(2,2-difluoroethoxy)propanamide |
|---|---|
| PubChem CID | 103212738 |
| Molecular Formula | C10H18BrF2NO2 |
| Molecular Weight | 302.16 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | N-(2-bromopentyl)-3-(2,2-difluoroethoxy)propanamide |
| SMILES | CCCC(Br)CNC(=O)CCOCC(F)F |
| InChI | InChI=1S/C10H18BrF2NO2/c1-2-3-8(11)6-14-10(15)4-5-16-7-9(12)13/h8-9H,2-7H2,1H3,(H,14,15) |
| InChIKey | RFEZIOQXAJIZSC-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.16 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|