C9H16ClF2NO3 — CID 103212347
N-(2-chloro-3-methoxypropyl)-3-(2,2-difluoroethoxy)propanamide (PubChem CID 103212347) has the molecular formula C9H16ClF2NO3 and a molecular weight of 259.68 g/mol. Its IUPAC name is N-(2-chloro-3-methoxypropyl)-3-(2,2-difluoroethoxy)propanamide.
| Compound Name | N-(2-chloro-3-methoxypropyl)-3-(2,2-difluoroethoxy)propanamide |
|---|---|
| PubChem CID | 103212347 |
| Molecular Formula | C9H16ClF2NO3 |
| Molecular Weight | 259.68 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | N-(2-chloro-3-methoxypropyl)-3-(2,2-difluoroethoxy)propanamide |
| SMILES | COCC(Cl)CNC(=O)CCOCC(F)F |
| InChI | InChI=1S/C9H16ClF2NO3/c1-15-5-7(10)4-13-9(14)2-3-16-6-8(11)12/h7-8H,2-6H2,1H3,(H,13,14) |
| InChIKey | SOUBDNYBKXUKQN-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.68 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|