C10H18ClF2NO2 — CID 107320973
N-(5-chloropentyl)-3-(2,2-difluoroethoxy)propanamide (PubChem CID 107320973) has the molecular formula C10H18ClF2NO2 and a molecular weight of 257.71 g/mol. Its IUPAC name is N-(5-chloropentyl)-3-(2,2-difluoroethoxy)propanamide.
| Compound Name | N-(5-chloropentyl)-3-(2,2-difluoroethoxy)propanamide |
|---|---|
| PubChem CID | 107320973 |
| Molecular Formula | C10H18ClF2NO2 |
| Molecular Weight | 257.71 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | N-(5-chloropentyl)-3-(2,2-difluoroethoxy)propanamide |
| SMILES | O=C(CCOCC(F)F)NCCCCCCl |
| InChI | InChI=1S/C10H18ClF2NO2/c11-5-2-1-3-6-14-10(15)4-7-16-8-9(12)13/h9H,1-8H2,(H,14,15) |
| InChIKey | SCMYVMFVAUJWHV-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.71 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|