C8H12ClF2NO2 — CID 103208987
N-(2-chloroprop-2-enyl)-3-(2,2-difluoroethoxy)propanamide (PubChem CID 103208987) has the molecular formula C8H12ClF2NO2 and a molecular weight of 227.64 g/mol. Its IUPAC name is N-(2-chloroprop-2-enyl)-3-(2,2-difluoroethoxy)propanamide.
| Compound Name | N-(2-chloroprop-2-enyl)-3-(2,2-difluoroethoxy)propanamide |
|---|---|
| PubChem CID | 103208987 |
| Molecular Formula | C8H12ClF2NO2 |
| Molecular Weight | 227.64 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | N-(2-chloroprop-2-enyl)-3-(2,2-difluoroethoxy)propanamide |
| SMILES | C=C(Cl)CNC(=O)CCOCC(F)F |
| InChI | InChI=1S/C8H12ClF2NO2/c1-6(9)4-12-8(13)2-3-14-5-7(10)11/h7H,1-5H2,(H,12,13) |
| InChIKey | OEGKEULXCLBBPC-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.64 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|