C5H7ClF2O2 — CID 103208649
3-(2,2-difluoroethoxy)propanoyl chloride (PubChem CID 103208649) has the molecular formula C5H7ClF2O2 and a molecular weight of 172.56 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)propanoyl chloride.
| Compound Name | 3-(2,2-difluoroethoxy)propanoyl chloride |
|---|---|
| PubChem CID | 103208649 |
| Molecular Formula | C5H7ClF2O2 |
| Molecular Weight | 172.56 g/mol |
| Exact Mass | 172.01 |
| IUPAC Name | 3-(2,2-difluoroethoxy)propanoyl chloride |
| SMILES | O=C(Cl)CCOCC(F)F |
| InChI | InChI=1S/C5H7ClF2O2/c6-4(9)1-2-10-3-5(7)8/h5H,1-3H2 |
| InChIKey | KTLZDYXFNSCEJL-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.56 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|