C9H12F2O2 — CID 103147266
1-(2,2-difluoroethoxy)hept-5-yn-3-one (PubChem CID 103147266) has the molecular formula C9H12F2O2 and a molecular weight of 190.19 g/mol. Its IUPAC name is 1-(2,2-difluoroethoxy)hept-5-yn-3-one.
| Compound Name | 1-(2,2-difluoroethoxy)hept-5-yn-3-one |
|---|---|
| PubChem CID | 103147266 |
| Molecular Formula | C9H12F2O2 |
| Molecular Weight | 190.19 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | 1-(2,2-difluoroethoxy)hept-5-yn-3-one |
| SMILES | CC#CCC(=O)CCOCC(F)F |
| InChI | InChI=1S/C9H12F2O2/c1-2-3-4-8(12)5-6-13-7-9(10)11/h9H,4-7H2,1H3 |
| InChIKey | XVNLZKSCEJCRDG-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.19 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|