C9H16F2O3 — CID 103147119
1-(2,2-difluoroethoxy)-6-methoxyhexan-3-one (PubChem CID 103147119) has the molecular formula C9H16F2O3 and a molecular weight of 210.22 g/mol. Its IUPAC name is 1-(2,2-difluoroethoxy)-6-methoxyhexan-3-one.
| Compound Name | 1-(2,2-difluoroethoxy)-6-methoxyhexan-3-one |
|---|---|
| PubChem CID | 103147119 |
| Molecular Formula | C9H16F2O3 |
| Molecular Weight | 210.22 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 1-(2,2-difluoroethoxy)-6-methoxyhexan-3-one |
| SMILES | COCCCC(=O)CCOCC(F)F |
| InChI | InChI=1S/C9H16F2O3/c1-13-5-2-3-8(12)4-6-14-7-9(10)11/h9H,2-7H2,1H3 |
| InChIKey | GWNPKKMSXLXMIF-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.22 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|