C10H18O4 — CID 139993978
1,8-dimethoxyoctane-4,5-dione (PubChem CID 139993978) has the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. Its IUPAC name is 1,8-dimethoxyoctane-4,5-dione.
| Compound Name | 1,8-dimethoxyoctane-4,5-dione |
|---|---|
| PubChem CID | 139993978 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 1,8-dimethoxyoctane-4,5-dione |
| SMILES | COCCCC(=O)C(=O)CCCOC |
| InChI | InChI=1S/C10H18O4/c1-13-7-3-5-9(11)10(12)6-4-8-14-2/h3-8H2,1-2H3 |
| InChIKey | LQPRTRDEQUMAJO-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|