About 4-methoxybutanamide
4-methoxybutanamide (PubChem CID 22414177) has the molecular formula C5H11NO2
and a molecular weight of 117.15 g/mol. Its IUPAC name is 4-methoxybutanamide.
Molecular Properties
| Compound Name | 4-methoxybutanamide |
| PubChem CID | 22414177 |
| Molecular Formula | C5H11NO2 |
| Molecular Weight | 117.15 g/mol |
| Exact Mass | 117.08 |
| IUPAC Name | 4-methoxybutanamide |
| SMILES | COCCCC(N)=O |
| InChI | InChI=1S/C5H11NO2/c1-8-4-2-3-5(6)7/h2-4H2,1H3,(H2,6,7) |
| InChIKey | XJXBWJFUCWOLSY-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.15 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxybutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxybutanamide?
The IUPAC name of 4-methoxybutanamide (CID 22414177) is 4-methoxybutanamide.
What is the SMILES notation for 4-methoxybutanamide?
The canonical SMILES for 4-methoxybutanamide is COCCCC(N)=O.
What is the InChIKey of 4-methoxybutanamide?
The InChIKey is XJXBWJFUCWOLSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO2/c1-8-4-2-3-5(6)7/h2-4H2,1H3,(H2,6,7).
What are the key properties of 4-methoxybutanamide?
4-methoxybutanamide has a molecular weight of 117.15 g/mol, XLogP of -0.10, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxybutanamide is sourced from PubChem (CID 22414177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).