About acetic acid;4-methoxybutanimidamide
acetic acid;4-methoxybutanimidamide (PubChem CID 162326172) has the molecular formula C7H16N2O3
and a molecular weight of 176.22 g/mol. Its IUPAC name is acetic acid;4-methoxybutanimidamide.
Molecular Properties
| Compound Name | acetic acid;4-methoxybutanimidamide |
| PubChem CID | 162326172 |
| Molecular Formula | C7H16N2O3 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | acetic acid;4-methoxybutanimidamide |
| SMILES | CC(=O)O.[H]/N=C(/N)CCCOC |
| InChI | InChI=1S/C5H12N2O.C2H4O2/c1-8-4-2-3-5(6)7;1-2(3)4/h2-4H2,1H3,(H3,6,7);1H3,(H,3,4) |
| InChIKey | NBNFPWWNROMTPX-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 96.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;4-methoxybutanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;4-methoxybutanimidamide?
The IUPAC name of acetic acid;4-methoxybutanimidamide (CID 162326172) is acetic acid;4-methoxybutanimidamide.
What is the SMILES notation for acetic acid;4-methoxybutanimidamide?
The canonical SMILES for acetic acid;4-methoxybutanimidamide is CC(=O)O.[H]/N=C(/N)CCCOC.
What is the InChIKey of acetic acid;4-methoxybutanimidamide?
The InChIKey is NBNFPWWNROMTPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2O.C2H4O2/c1-8-4-2-3-5(6)7;1-2(3)4/h2-4H2,1H3,(H3,6,7);1H3,(H,3,4).
What are the key properties of acetic acid;4-methoxybutanimidamide?
acetic acid;4-methoxybutanimidamide has a molecular weight of 176.22 g/mol, XLogP of 0.44, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;4-methoxybutanimidamide is sourced from PubChem (CID 162326172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).