C12H25N3O4 — CID 167720461
acetic acid;tert-butyl N-(5-amino-5-iminopentyl)carbamate (PubChem CID 167720461) has the molecular formula C12H25N3O4 and a molecular weight of 275.35 g/mol. Its IUPAC name is acetic acid;tert-butyl N-(5-amino-5-iminopentyl)carbamate.
| Compound Name | acetic acid;tert-butyl N-(5-amino-5-iminopentyl)carbamate |
|---|---|
| PubChem CID | 167720461 |
| Molecular Formula | C12H25N3O4 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.18 |
| IUPAC Name | acetic acid;tert-butyl N-(5-amino-5-iminopentyl)carbamate |
| SMILES | CC(=O)O.[H]/N=C(\N)CCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H21N3O2.C2H4O2/c1-10(2,3)15-9(14)13-7-5-4-6-8(11)12;1-2(3)4/h4-7H2,1-3H3,(H3,11,12)(H,13,14);1H3,(H,3,4) |
| InChIKey | FKAMORKRHQMDFQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 125.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|