About (4-amino-4-iminobutyl) acetate
(4-amino-4-iminobutyl) acetate (PubChem CID 118644708) has the molecular formula C6H12N2O2
and a molecular weight of 144.17 g/mol. Its IUPAC name is (4-amino-4-iminobutyl) acetate.
Molecular Properties
| Compound Name | (4-amino-4-iminobutyl) acetate |
| PubChem CID | 118644708 |
| Molecular Formula | C6H12N2O2 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | (4-amino-4-iminobutyl) acetate |
| SMILES | [H]/N=C(\N)CCCOC(C)=O |
| InChI | InChI=1S/C6H12N2O2/c1-5(9)10-4-2-3-6(7)8/h2-4H2,1H3,(H3,7,8) |
| InChIKey | ZRMBCGRVYWBXNJ-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 76.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (4-amino-4-iminobutyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-amino-4-iminobutyl) acetate?
The IUPAC name of (4-amino-4-iminobutyl) acetate (CID 118644708) is (4-amino-4-iminobutyl) acetate.
What is the SMILES notation for (4-amino-4-iminobutyl) acetate?
The canonical SMILES for (4-amino-4-iminobutyl) acetate is [H]/N=C(\N)CCCOC(C)=O.
What is the InChIKey of (4-amino-4-iminobutyl) acetate?
The InChIKey is ZRMBCGRVYWBXNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O2/c1-5(9)10-4-2-3-6(7)8/h2-4H2,1H3,(H3,7,8).
What are the key properties of (4-amino-4-iminobutyl) acetate?
(4-amino-4-iminobutyl) acetate has a molecular weight of 144.17 g/mol, XLogP of 0.27, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-amino-4-iminobutyl) acetate is sourced from PubChem (CID 118644708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).