About 4-silyloxybutanamide
4-silyloxybutanamide (PubChem CID 172753753) has the molecular formula C4H11NO2Si
and a molecular weight of 133.22 g/mol. Its IUPAC name is 4-silyloxybutanamide.
Molecular Properties
| Compound Name | 4-silyloxybutanamide |
| PubChem CID | 172753753 |
| Molecular Formula | C4H11NO2Si |
| Molecular Weight | 133.22 g/mol |
| Exact Mass | 133.06 |
| IUPAC Name | 4-silyloxybutanamide |
| SMILES | NC(=O)CCCO[SiH3] |
| InChI | InChI=1S/C4H11NO2Si/c5-4(6)2-1-3-7-8/h1-3H2,8H3,(H2,5,6) |
| InChIKey | KSRRCTKIIFRCPR-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.22 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-silyloxybutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-silyloxybutanamide?
The IUPAC name of 4-silyloxybutanamide (CID 172753753) is 4-silyloxybutanamide.
What is the SMILES notation for 4-silyloxybutanamide?
The canonical SMILES for 4-silyloxybutanamide is NC(=O)CCCO[SiH3].
What is the InChIKey of 4-silyloxybutanamide?
The InChIKey is KSRRCTKIIFRCPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11NO2Si/c5-4(6)2-1-3-7-8/h1-3H2,8H3,(H2,5,6).
What are the key properties of 4-silyloxybutanamide?
4-silyloxybutanamide has a molecular weight of 133.22 g/mol, XLogP of -1.45, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-silyloxybutanamide is sourced from PubChem (CID 172753753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).