About 5-methoxypentan-2-one acetate
5-methoxypentan-2-one acetate (PubChem CID 123446374) has the molecular formula C8H15O4-
and a molecular weight of 175.20 g/mol. Its IUPAC name is 5-methoxypentan-2-one acetate.
Molecular Properties
| Compound Name | 5-methoxypentan-2-one acetate |
| PubChem CID | 123446374 |
| Molecular Formula | C8H15O4- |
| Molecular Weight | 175.20 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 5-methoxypentan-2-one acetate |
| SMILES | CC(=O)[O-].COCCCC(C)=O |
| InChI | InChI=1S/C6H12O2.C2H4O2/c1-6(7)4-3-5-8-2;1-2(3)4/h3-5H2,1-2H3;1H3,(H,3,4)/p-1 |
| InChIKey | SQAZQZVGQPEWSQ-UHFFFAOYSA-M |
| XLogP | -0.24 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.20 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-methoxypentan-2-one acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxypentan-2-one acetate?
The IUPAC name of 5-methoxypentan-2-one acetate (CID 123446374) is 5-methoxypentan-2-one acetate.
What is the SMILES notation for 5-methoxypentan-2-one acetate?
The canonical SMILES for 5-methoxypentan-2-one acetate is CC(=O)[O-].COCCCC(C)=O.
What is the InChIKey of 5-methoxypentan-2-one acetate?
The InChIKey is SQAZQZVGQPEWSQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H12O2.C2H4O2/c1-6(7)4-3-5-8-2;1-2(3)4/h3-5H2,1-2H3;1H3,(H,3,4)/p-1.
What are the key properties of 5-methoxypentan-2-one acetate?
5-methoxypentan-2-one acetate has a molecular weight of 175.20 g/mol, XLogP of -0.24, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxypentan-2-one acetate is sourced from PubChem (CID 123446374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).