About hexan-2-one;2-methoxyethanol
hexan-2-one;2-methoxyethanol (PubChem CID 158133089) has the molecular formula C9H20O3
and a molecular weight of 176.26 g/mol. Its IUPAC name is hexan-2-one;2-methoxyethanol.
Molecular Properties
| Compound Name | hexan-2-one;2-methoxyethanol |
| PubChem CID | 158133089 |
| Molecular Formula | C9H20O3 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.14 |
| IUPAC Name | hexan-2-one;2-methoxyethanol |
| SMILES | CCCCC(C)=O.COCCO |
| InChI | InChI=1S/C6H12O.C3H8O2/c1-3-4-5-6(2)7;1-5-3-2-4/h3-5H2,1-2H3;4H,2-3H2,1H3 |
| InChIKey | FTADUOOPBWLROW-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze hexan-2-one;2-methoxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexan-2-one;2-methoxyethanol?
The IUPAC name of hexan-2-one;2-methoxyethanol (CID 158133089) is hexan-2-one;2-methoxyethanol.
What is the SMILES notation for hexan-2-one;2-methoxyethanol?
The canonical SMILES for hexan-2-one;2-methoxyethanol is CCCCC(C)=O.COCCO.
What is the InChIKey of hexan-2-one;2-methoxyethanol?
The InChIKey is FTADUOOPBWLROW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O.C3H8O2/c1-3-4-5-6(2)7;1-5-3-2-4/h3-5H2,1-2H3;4H,2-3H2,1H3.
What are the key properties of hexan-2-one;2-methoxyethanol?
hexan-2-one;2-methoxyethanol has a molecular weight of 176.26 g/mol, XLogP of 1.39, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hexan-2-one;2-methoxyethanol is sourced from PubChem (CID 158133089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).