About ethane-1,2-diol;henicosan-2-one
ethane-1,2-diol;henicosan-2-one (PubChem CID 167612528) has the molecular formula C23H48O3
and a molecular weight of 372.63 g/mol. Its IUPAC name is ethane-1,2-diol;henicosan-2-one.
Molecular Properties
| Compound Name | ethane-1,2-diol;henicosan-2-one |
| PubChem CID | 167612528 |
| Molecular Formula | C23H48O3 |
| Molecular Weight | 372.63 g/mol |
| Exact Mass | 372.36 |
| IUPAC Name | ethane-1,2-diol;henicosan-2-one |
| SMILES | CCCCCCCCCCCCCCCCCCCC(C)=O.OCCO |
| InChI | InChI=1S/C21H42O.C2H6O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(2)22;3-1-2-4/h3-20H2,1-2H3;3-4H,1-2H2 |
| InChIKey | LGNFVKXUUOKWER-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.63 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane-1,2-diol;henicosan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane-1,2-diol;henicosan-2-one?
The IUPAC name of ethane-1,2-diol;henicosan-2-one (CID 167612528) is ethane-1,2-diol;henicosan-2-one.
What is the SMILES notation for ethane-1,2-diol;henicosan-2-one?
The canonical SMILES for ethane-1,2-diol;henicosan-2-one is CCCCCCCCCCCCCCCCCCCC(C)=O.OCCO.
What is the InChIKey of ethane-1,2-diol;henicosan-2-one?
The InChIKey is LGNFVKXUUOKWER-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H42O.C2H6O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(2)22;3-1-2-4/h3-20H2,1-2H3;3-4H,1-2H2.
What are the key properties of ethane-1,2-diol;henicosan-2-one?
ethane-1,2-diol;henicosan-2-one has a molecular weight of 372.63 g/mol, XLogP of 6.59, 19 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane-1,2-diol;henicosan-2-one is sourced from PubChem (CID 167612528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).