About butan-1-ol;heptan-2-one
butan-1-ol;heptan-2-one (PubChem CID 87902708) has the molecular formula C11H24O2
and a molecular weight of 188.31 g/mol. Its IUPAC name is butan-1-ol;heptan-2-one.
Molecular Properties
| Compound Name | butan-1-ol;heptan-2-one |
| PubChem CID | 87902708 |
| Molecular Formula | C11H24O2 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.18 |
| IUPAC Name | butan-1-ol;heptan-2-one |
| SMILES | CCCCCC(C)=O.CCCCO |
| InChI | InChI=1S/C7H14O.C4H10O/c1-3-4-5-6-7(2)8;1-2-3-4-5/h3-6H2,1-2H3;5H,2-4H2,1H3 |
| InChIKey | JCKKTJHAOYOUFV-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butan-1-ol;heptan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-1-ol;heptan-2-one?
The IUPAC name of butan-1-ol;heptan-2-one (CID 87902708) is butan-1-ol;heptan-2-one.
What is the SMILES notation for butan-1-ol;heptan-2-one?
The canonical SMILES for butan-1-ol;heptan-2-one is CCCCCC(C)=O.CCCCO.
What is the InChIKey of butan-1-ol;heptan-2-one?
The InChIKey is JCKKTJHAOYOUFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O.C4H10O/c1-3-4-5-6-7(2)8;1-2-3-4-5/h3-6H2,1-2H3;5H,2-4H2,1H3.
What are the key properties of butan-1-ol;heptan-2-one?
butan-1-ol;heptan-2-one has a molecular weight of 188.31 g/mol, XLogP of 2.93, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butan-1-ol;heptan-2-one is sourced from PubChem (CID 87902708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).