About 6-methoxy-3-oxohexanoic acid
6-methoxy-3-oxohexanoic acid (PubChem CID 57018252) has the molecular formula C7H12O4
and a molecular weight of 160.17 g/mol. Its IUPAC name is 6-methoxy-3-oxohexanoic acid.
Molecular Properties
| Compound Name | 6-methoxy-3-oxohexanoic acid |
| PubChem CID | 57018252 |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 6-methoxy-3-oxohexanoic acid |
| SMILES | COCCCC(=O)CC(=O)O |
| InChI | InChI=1S/C7H12O4/c1-11-4-2-3-6(8)5-7(9)10/h2-5H2,1H3,(H,9,10) |
| InChIKey | KKCDLUBZLUAFAF-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 6-methoxy-3-oxohexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-3-oxohexanoic acid?
The IUPAC name of 6-methoxy-3-oxohexanoic acid (CID 57018252) is 6-methoxy-3-oxohexanoic acid.
What is the SMILES notation for 6-methoxy-3-oxohexanoic acid?
The canonical SMILES for 6-methoxy-3-oxohexanoic acid is COCCCC(=O)CC(=O)O.
What is the InChIKey of 6-methoxy-3-oxohexanoic acid?
The InChIKey is KKCDLUBZLUAFAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O4/c1-11-4-2-3-6(8)5-7(9)10/h2-5H2,1H3,(H,9,10).
What are the key properties of 6-methoxy-3-oxohexanoic acid?
6-methoxy-3-oxohexanoic acid has a molecular weight of 160.17 g/mol, XLogP of 0.46, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-3-oxohexanoic acid is sourced from PubChem (CID 57018252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).