About 7-methoxy-2-oxoheptanoic acid
7-methoxy-2-oxoheptanoic acid (PubChem CID 91618473) has the molecular formula C8H14O4
and a molecular weight of 174.20 g/mol. Its IUPAC name is 7-methoxy-2-oxoheptanoic acid.
Molecular Properties
| Compound Name | 7-methoxy-2-oxoheptanoic acid |
| PubChem CID | 91618473 |
| Molecular Formula | C8H14O4 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 7-methoxy-2-oxoheptanoic acid |
| SMILES | COCCCCCC(=O)C(=O)O |
| InChI | InChI=1S/C8H14O4/c1-12-6-4-2-3-5-7(9)8(10)11/h2-6H2,1H3,(H,10,11) |
| InChIKey | WIBCGNAQXMZZIV-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 7-methoxy-2-oxoheptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-2-oxoheptanoic acid?
The IUPAC name of 7-methoxy-2-oxoheptanoic acid (CID 91618473) is 7-methoxy-2-oxoheptanoic acid.
What is the SMILES notation for 7-methoxy-2-oxoheptanoic acid?
The canonical SMILES for 7-methoxy-2-oxoheptanoic acid is COCCCCCC(=O)C(=O)O.
What is the InChIKey of 7-methoxy-2-oxoheptanoic acid?
The InChIKey is WIBCGNAQXMZZIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O4/c1-12-6-4-2-3-5-7(9)8(10)11/h2-6H2,1H3,(H,10,11).
What are the key properties of 7-methoxy-2-oxoheptanoic acid?
7-methoxy-2-oxoheptanoic acid has a molecular weight of 174.20 g/mol, XLogP of 0.85, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-2-oxoheptanoic acid is sourced from PubChem (CID 91618473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).