chromium;2-oxooctanoic acid

C8H14CrO3 — CID 174981458

IUPACchromium;2-oxooctanoic acid
SMILESCCCCCCC(=O)C(=O)O.[Cr]
InChIInChI=1S/C8H14O3.Cr/c1-2-3-4-5-6-7(9)8(10)11;/h2-6H2,1H3,(H,10,11);
InChIKeyBENSREAHSMQWEN-UHFFFAOYSA-N
MW210.19 g/mol
LogP1.61
Rot. Bonds6

About chromium;2-oxooctanoic acid

chromium;2-oxooctanoic acid (PubChem CID 174981458) has the molecular formula C8H14CrO3 and a molecular weight of 210.19 g/mol. Its IUPAC name is chromium;2-oxooctanoic acid.

Molecular Properties

Compound Namechromium;2-oxooctanoic acid
PubChem CID174981458
Molecular FormulaC8H14CrO3
Molecular Weight210.19 g/mol
Exact Mass210.03
IUPAC Namechromium;2-oxooctanoic acid
SMILESCCCCCCC(=O)C(=O)O.[Cr]
InChIInChI=1S/C8H14O3.Cr/c1-2-3-4-5-6-7(9)8(10)11;/h2-6H2,1H3,(H,10,11);
InChIKeyBENSREAHSMQWEN-UHFFFAOYSA-N
XLogP1.61
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.19
LogP ≤ 51.61
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze chromium;2-oxooctanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of chromium;2-oxooctanoic acid?
The IUPAC name of chromium;2-oxooctanoic acid (CID 174981458) is chromium;2-oxooctanoic acid.
What is the SMILES notation for chromium;2-oxooctanoic acid?
The canonical SMILES for chromium;2-oxooctanoic acid is CCCCCCC(=O)C(=O)O.[Cr].
What is the InChIKey of chromium;2-oxooctanoic acid?
The InChIKey is BENSREAHSMQWEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O3.Cr/c1-2-3-4-5-6-7(9)8(10)11;/h2-6H2,1H3,(H,10,11);.
What are the key properties of chromium;2-oxooctanoic acid?
chromium;2-oxooctanoic acid has a molecular weight of 210.19 g/mol, XLogP of 1.61, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chromium;2-oxooctanoic acid is sourced from PubChem (CID 174981458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).