About 2,4-dioxodecanoic acid
2,4-dioxodecanoic acid (PubChem CID 21475711) has the molecular formula C10H16O4
and a molecular weight of 200.23 g/mol. Its IUPAC name is 2,4-dioxodecanoic acid.
Molecular Properties
| Compound Name | 2,4-dioxodecanoic acid |
| PubChem CID | 21475711 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 2,4-dioxodecanoic acid |
| SMILES | CCCCCCC(=O)CC(=O)C(=O)O |
| InChI | InChI=1S/C10H16O4/c1-2-3-4-5-6-8(11)7-9(12)10(13)14/h2-7H2,1H3,(H,13,14) |
| InChIKey | UUUQYPPQWMUNDH-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dioxodecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dioxodecanoic acid?
The IUPAC name of 2,4-dioxodecanoic acid (CID 21475711) is 2,4-dioxodecanoic acid.
What is the SMILES notation for 2,4-dioxodecanoic acid?
The canonical SMILES for 2,4-dioxodecanoic acid is CCCCCCC(=O)CC(=O)C(=O)O.
What is the InChIKey of 2,4-dioxodecanoic acid?
The InChIKey is UUUQYPPQWMUNDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O4/c1-2-3-4-5-6-8(11)7-9(12)10(13)14/h2-7H2,1H3,(H,13,14).
What are the key properties of 2,4-dioxodecanoic acid?
2,4-dioxodecanoic acid has a molecular weight of 200.23 g/mol, XLogP of 1.57, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dioxodecanoic acid is sourced from PubChem (CID 21475711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).