About 2-oxoheptadecanoic acid
2-oxoheptadecanoic acid (PubChem CID 5312901) has the molecular formula C17H32O3
and a molecular weight of 284.44 g/mol. Its IUPAC name is 2-oxoheptadecanoic acid.
Molecular Properties
| Compound Name | 2-oxoheptadecanoic acid |
| PubChem CID | 5312901 |
| Molecular Formula | C17H32O3 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.24 |
| IUPAC Name | 2-oxoheptadecanoic acid |
| SMILES | CCCCCCCCCCCCCCCC(=O)C(=O)O |
| InChI | InChI=1S/C17H32O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(18)17(19)20/h2-15H2,1H3,(H,19,20) |
| InChIKey | QPDMNFFZLIUVIV-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-oxoheptadecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxoheptadecanoic acid?
The IUPAC name of 2-oxoheptadecanoic acid (CID 5312901) is 2-oxoheptadecanoic acid.
What is the SMILES notation for 2-oxoheptadecanoic acid?
The canonical SMILES for 2-oxoheptadecanoic acid is CCCCCCCCCCCCCCCC(=O)C(=O)O.
What is the InChIKey of 2-oxoheptadecanoic acid?
The InChIKey is QPDMNFFZLIUVIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(18)17(19)20/h2-15H2,1H3,(H,19,20).
What are the key properties of 2-oxoheptadecanoic acid?
2-oxoheptadecanoic acid has a molecular weight of 284.44 g/mol, XLogP of 5.12, 15 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxoheptadecanoic acid is sourced from PubChem (CID 5312901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).