About 3,4-dioxononadecanoic acid
3,4-dioxononadecanoic acid (PubChem CID 155267286) has the molecular formula C19H34O4
and a molecular weight of 326.48 g/mol. Its IUPAC name is 3,4-dioxononadecanoic acid.
Molecular Properties
| Compound Name | 3,4-dioxononadecanoic acid |
| PubChem CID | 155267286 |
| Molecular Formula | C19H34O4 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | 3,4-dioxononadecanoic acid |
| SMILES | CCCCCCCCCCCCCCCC(=O)C(=O)CC(=O)O |
| InChI | InChI=1S/C19H34O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-17(20)18(21)16-19(22)23/h2-16H2,1H3,(H,22,23) |
| InChIKey | NMOLTWBZLYDWFU-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dioxononadecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dioxononadecanoic acid?
The IUPAC name of 3,4-dioxononadecanoic acid (CID 155267286) is 3,4-dioxononadecanoic acid.
What is the SMILES notation for 3,4-dioxononadecanoic acid?
The canonical SMILES for 3,4-dioxononadecanoic acid is CCCCCCCCCCCCCCCC(=O)C(=O)CC(=O)O.
What is the InChIKey of 3,4-dioxononadecanoic acid?
The InChIKey is NMOLTWBZLYDWFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H34O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-17(20)18(21)16-19(22)23/h2-16H2,1H3,(H,22,23).
What are the key properties of 3,4-dioxononadecanoic acid?
3,4-dioxononadecanoic acid has a molecular weight of 326.48 g/mol, XLogP of 5.08, 17 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dioxononadecanoic acid is sourced from PubChem (CID 155267286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).