C7H10O4 — CID 23169167
2,4-dioxoheptanoic acid (PubChem CID 23169167) has the molecular formula C7H10O4 and a molecular weight of 158.15 g/mol. Its IUPAC name is 2,4-dioxoheptanoic acid.
| Compound Name | 2,4-dioxoheptanoic acid |
|---|---|
| PubChem CID | 23169167 |
| Molecular Formula | C7H10O4 |
| Molecular Weight | 158.15 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | 2,4-dioxoheptanoic acid |
| SMILES | CCCC(=O)CC(=O)C(=O)O |
| InChI | InChI=1S/C7H10O4/c1-2-3-5(8)4-6(9)7(10)11/h2-4H2,1H3,(H,10,11) |
| InChIKey | HCKUOPXBZCRCKN-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.15 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|