About bis(3-oxohexanoic acid);silane
bis(3-oxohexanoic acid);silane (PubChem CID 175228530) has the molecular formula C12H24O6Si
and a molecular weight of 292.40 g/mol. Its IUPAC name is bis(3-oxohexanoic acid);silane.
Molecular Properties
| Compound Name | bis(3-oxohexanoic acid);silane |
| PubChem CID | 175228530 |
| Molecular Formula | C12H24O6Si |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | bis(3-oxohexanoic acid);silane |
| SMILES | CCCC(=O)CC(=O)O.CCCC(=O)CC(=O)O.[SiH4] |
| InChI | InChI=1S/2C6H10O3.H4Si/c2*1-2-3-5(7)4-6(8)9;/h2*2-4H2,1H3,(H,8,9);1H4 |
| InChIKey | BNPPNHIBUPSDCO-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(3-oxohexanoic acid);silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3-oxohexanoic acid);silane?
The IUPAC name of bis(3-oxohexanoic acid);silane (CID 175228530) is bis(3-oxohexanoic acid);silane.
What is the SMILES notation for bis(3-oxohexanoic acid);silane?
The canonical SMILES for bis(3-oxohexanoic acid);silane is CCCC(=O)CC(=O)O.CCCC(=O)CC(=O)O.[SiH4].
What is the InChIKey of bis(3-oxohexanoic acid);silane?
The InChIKey is BNPPNHIBUPSDCO-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H10O3.H4Si/c2*1-2-3-5(7)4-6(8)9;/h2*2-4H2,1H3,(H,8,9);1H4.
What are the key properties of bis(3-oxohexanoic acid);silane?
bis(3-oxohexanoic acid);silane has a molecular weight of 292.40 g/mol, XLogP of 0.21, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3-oxohexanoic acid);silane is sourced from PubChem (CID 175228530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).