About 2-ethoxyethanol;3-oxohexanoic acid
2-ethoxyethanol;3-oxohexanoic acid (PubChem CID 88812724) has the molecular formula C10H20O5
and a molecular weight of 220.26 g/mol. Its IUPAC name is 2-ethoxyethanol;3-oxohexanoic acid.
Molecular Properties
| Compound Name | 2-ethoxyethanol;3-oxohexanoic acid |
| PubChem CID | 88812724 |
| Molecular Formula | C10H20O5 |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 2-ethoxyethanol;3-oxohexanoic acid |
| SMILES | CCCC(=O)CC(=O)O.CCOCCO |
| InChI | InChI=1S/C6H10O3.C4H10O2/c1-2-3-5(7)4-6(8)9;1-2-6-4-3-5/h2-4H2,1H3,(H,8,9);5H,2-4H2,1H3 |
| InChIKey | OONRJRFKAYVXJN-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxyethanol;3-oxohexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxyethanol;3-oxohexanoic acid?
The IUPAC name of 2-ethoxyethanol;3-oxohexanoic acid (CID 88812724) is 2-ethoxyethanol;3-oxohexanoic acid.
What is the SMILES notation for 2-ethoxyethanol;3-oxohexanoic acid?
The canonical SMILES for 2-ethoxyethanol;3-oxohexanoic acid is CCCC(=O)CC(=O)O.CCOCCO.
What is the InChIKey of 2-ethoxyethanol;3-oxohexanoic acid?
The InChIKey is OONRJRFKAYVXJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3.C4H10O2/c1-2-3-5(7)4-6(8)9;1-2-6-4-3-5/h2-4H2,1H3,(H,8,9);5H,2-4H2,1H3.
What are the key properties of 2-ethoxyethanol;3-oxohexanoic acid?
2-ethoxyethanol;3-oxohexanoic acid has a molecular weight of 220.26 g/mol, XLogP of 0.85, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxyethanol;3-oxohexanoic acid is sourced from PubChem (CID 88812724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).