C15H34O7 — CID 87832524
2-[2-(2-hydroxyethoxy)ethoxy]ethanol;propanoic acid;1-propoxypropane (PubChem CID 87832524) has the molecular formula C15H34O7 and a molecular weight of 326.43 g/mol. Its IUPAC name is 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;propanoic acid;1-propoxypropane.
| Compound Name | 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;propanoic acid;1-propoxypropane |
|---|---|
| PubChem CID | 87832524 |
| Molecular Formula | C15H34O7 |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.23 |
| IUPAC Name | 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;propanoic acid;1-propoxypropane |
| SMILES | CCC(=O)O.CCCOCCC.OCCOCCOCCO |
| InChI | InChI=1S/C6H14O4.C6H14O.C3H6O2/c7-1-3-9-5-6-10-4-2-8;1-3-5-7-6-4-2;1-2-3(4)5/h7-8H,1-6H2;3-6H2,1-2H3;2H2,1H3,(H,4,5) |
| InChIKey | UQWVHKXLNFNUEN-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|