C15H32O12 — CID 87459170
2,3-dihydroxybutanedioic acid;2-(2-hydroxyethoxy)ethanol;2-(2-propoxyethoxy)ethanol (PubChem CID 87459170) has the molecular formula C15H32O12 and a molecular weight of 404.41 g/mol. Its IUPAC name is 2,3-dihydroxybutanedioic acid;2-(2-hydroxyethoxy)ethanol;2-(2-propoxyethoxy)ethanol.
| Compound Name | 2,3-dihydroxybutanedioic acid;2-(2-hydroxyethoxy)ethanol;2-(2-propoxyethoxy)ethanol |
|---|---|
| PubChem CID | 87459170 |
| Molecular Formula | C15H32O12 |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | 2,3-dihydroxybutanedioic acid;2-(2-hydroxyethoxy)ethanol;2-(2-propoxyethoxy)ethanol |
| SMILES | CCCOCCOCCO.O=C(O)C(O)C(O)C(=O)O.OCCOCCO |
| InChI | InChI=1S/C7H16O3.C4H6O6.C4H10O3/c1-2-4-9-6-7-10-5-3-8;5-1(3(7)8)2(6)4(9)10;5-1-3-7-4-2-6/h8H,2-7H2,1H3;1-2,5-6H,(H,7,8)(H,9,10);5-6H,1-4H2 |
| InChIKey | WIISJPJUTYGKGH-UHFFFAOYSA-N |
| XLogP | -2.71 |
| TPSA | 203.44 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | -2.71 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|