C20H42O9 — CID 87064442
bis(hexanoic acid);2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol (PubChem CID 87064442) has the molecular formula C20H42O9 and a molecular weight of 426.55 g/mol. Its IUPAC name is bis(hexanoic acid);2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol.
| Compound Name | bis(hexanoic acid);2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 87064442 |
| Molecular Formula | C20H42O9 |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.28 |
| IUPAC Name | bis(hexanoic acid);2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol |
| SMILES | CCCCCC(=O)O.CCCCCC(=O)O.OCCOCCOCCOCCO |
| InChI | InChI=1S/C8H18O5.2C6H12O2/c9-1-3-11-5-7-13-8-6-12-4-2-10;2*1-2-3-4-5-6(7)8/h9-10H,1-8H2;2*2-5H2,1H3,(H,7,8) |
| InChIKey | NXGJGBIGLQOPJC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|