acetic acid;2-(2-hydroxyethoxy)ethanol;octadec-9-enoic acid

C24H48O7 — CID 173013662

IUPACacetic acid;2-(2-hydroxyethoxy)ethanol;octadec-9-enoic acid
SMILESCC(=O)O.CCCCCCCCC=CCCCCCCCC(=O)O.OCCOCCO
InChIInChI=1S/C18H34O2.C4H10O3.C2H4O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;5-1-3-7-4-2-6;1-2(3)4/h9-10H,2-8,11-17H2,1H3,(H,19,20);5-6H,1-4H2;1H3,(H,3,4)
InChIKeyWXISCFBOVBLSKT-UHFFFAOYSA-N
MW448.64 g/mol
LogP5.19
Rot. Bonds19

About acetic acid;2-(2-hydroxyethoxy)ethanol;octadec-9-enoic acid

acetic acid;2-(2-hydroxyethoxy)ethanol;octadec-9-enoic acid (PubChem CID 173013662) has the molecular formula C24H48O7 and a molecular weight of 448.64 g/mol. Its IUPAC name is acetic acid;2-(2-hydroxyethoxy)ethanol;octadec-9-enoic acid.

Molecular Properties

Compound Nameacetic acid;2-(2-hydroxyethoxy)ethanol;octadec-9-enoic acid
PubChem CID173013662
Molecular FormulaC24H48O7
Molecular Weight448.64 g/mol
Exact Mass448.34
IUPAC Nameacetic acid;2-(2-hydroxyethoxy)ethanol;octadec-9-enoic acid
SMILESCC(=O)O.CCCCCCCCC=CCCCCCCCC(=O)O.OCCOCCO
InChIInChI=1S/C18H34O2.C4H10O3.C2H4O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;5-1-3-7-4-2-6;1-2(3)4/h9-10H,2-8,11-17H2,1H3,(H,19,20);5-6H,1-4H2;1H3,(H,3,4)
InChIKeyWXISCFBOVBLSKT-UHFFFAOYSA-N
XLogP5.19
TPSA124.29 Ų
H-Bond Donors4
H-Bond Acceptors5
Rotatable Bonds19
Heavy Atoms31
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500448.64
LogP ≤ 55.19
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze acetic acid;2-(2-hydroxyethoxy)ethanol;octadec-9-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;2-(2-hydroxyethoxy)ethanol;octadec-9-enoic acid?
The IUPAC name of acetic acid;2-(2-hydroxyethoxy)ethanol;octadec-9-enoic acid (CID 173013662) is acetic acid;2-(2-hydroxyethoxy)ethanol;octadec-9-enoic acid.
What is the SMILES notation for acetic acid;2-(2-hydroxyethoxy)ethanol;octadec-9-enoic acid?
The canonical SMILES for acetic acid;2-(2-hydroxyethoxy)ethanol;octadec-9-enoic acid is CC(=O)O.CCCCCCCCC=CCCCCCCCC(=O)O.OCCOCCO.
What is the InChIKey of acetic acid;2-(2-hydroxyethoxy)ethanol;octadec-9-enoic acid?
The InChIKey is WXISCFBOVBLSKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34O2.C4H10O3.C2H4O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;5-1-3-7-4-2-6;1-2(3)4/h9-10H,2-8,11-17H2,1H3,(H,19,20);5-6H,1-4H2;1H3,(H,3,4).
What are the key properties of acetic acid;2-(2-hydroxyethoxy)ethanol;octadec-9-enoic acid?
acetic acid;2-(2-hydroxyethoxy)ethanol;octadec-9-enoic acid has a molecular weight of 448.64 g/mol, XLogP of 5.19, 19 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;2-(2-hydroxyethoxy)ethanol;octadec-9-enoic acid is sourced from PubChem (CID 173013662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).