C24H48O7 — CID 173013662
acetic acid;2-(2-hydroxyethoxy)ethanol;octadec-9-enoic acid (PubChem CID 173013662) has the molecular formula C24H48O7 and a molecular weight of 448.64 g/mol. Its IUPAC name is acetic acid;2-(2-hydroxyethoxy)ethanol;octadec-9-enoic acid.
| Compound Name | acetic acid;2-(2-hydroxyethoxy)ethanol;octadec-9-enoic acid |
|---|---|
| PubChem CID | 173013662 |
| Molecular Formula | C24H48O7 |
| Molecular Weight | 448.64 g/mol |
| Exact Mass | 448.34 |
| IUPAC Name | acetic acid;2-(2-hydroxyethoxy)ethanol;octadec-9-enoic acid |
| SMILES | CC(=O)O.CCCCCCCCC=CCCCCCCCC(=O)O.OCCOCCO |
| InChI | InChI=1S/C18H34O2.C4H10O3.C2H4O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;5-1-3-7-4-2-6;1-2(3)4/h9-10H,2-8,11-17H2,1H3,(H,19,20);5-6H,1-4H2;1H3,(H,3,4) |
| InChIKey | WXISCFBOVBLSKT-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.64 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|