C13H28O6 — CID 87510106
heptanoic acid;2-[2-(2-hydroxyethoxy)ethoxy]ethanol (PubChem CID 87510106) has the molecular formula C13H28O6 and a molecular weight of 280.36 g/mol. Its IUPAC name is heptanoic acid;2-[2-(2-hydroxyethoxy)ethoxy]ethanol.
| Compound Name | heptanoic acid;2-[2-(2-hydroxyethoxy)ethoxy]ethanol |
|---|---|
| PubChem CID | 87510106 |
| Molecular Formula | C13H28O6 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | heptanoic acid;2-[2-(2-hydroxyethoxy)ethoxy]ethanol |
| SMILES | CCCCCCC(=O)O.OCCOCCOCCO |
| InChI | InChI=1S/C7H14O2.C6H14O4/c1-2-3-4-5-6-7(8)9;7-1-3-9-5-6-10-4-2-8/h2-6H2,1H3,(H,8,9);7-8H,1-6H2 |
| InChIKey | IQJWWKYQAXQLRE-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|