C24H46O5 — CID 175146273
2-(2-ethoxyethoxy)ethanol;(9Z,12Z)-octadeca-9,12-dienoic acid (PubChem CID 175146273) has the molecular formula C24H46O5 and a molecular weight of 414.63 g/mol. Its IUPAC name is 2-(2-ethoxyethoxy)ethanol;(9Z,12Z)-octadeca-9,12-dienoic acid.
| Compound Name | 2-(2-ethoxyethoxy)ethanol;(9Z,12Z)-octadeca-9,12-dienoic acid |
|---|---|
| PubChem CID | 175146273 |
| Molecular Formula | C24H46O5 |
| Molecular Weight | 414.63 g/mol |
| Exact Mass | 414.33 |
| IUPAC Name | 2-(2-ethoxyethoxy)ethanol;(9Z,12Z)-octadeca-9,12-dienoic acid |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)O.CCOCCOCCO |
| InChI | InChI=1S/C18H32O2.C6H14O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-2-8-5-6-9-4-3-7/h6-7,9-10H,2-5,8,11-17H2,1H3,(H,19,20);7H,2-6H2,1H3/b7-6-,10-9-; |
| InChIKey | HWYWCPKPCPQKOQ-NBTZWHCOSA-N |
| XLogP | 5.92 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.63 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|