About 3-oxohexanedioic acid;sulfane
3-oxohexanedioic acid;sulfane (PubChem CID 174916165) has the molecular formula C6H10O5S
and a molecular weight of 194.21 g/mol. Its IUPAC name is 3-oxohexanedioic acid;sulfane.
Molecular Properties
| Compound Name | 3-oxohexanedioic acid;sulfane |
| PubChem CID | 174916165 |
| Molecular Formula | C6H10O5S |
| Molecular Weight | 194.21 g/mol |
| Exact Mass | 194.02 |
| IUPAC Name | 3-oxohexanedioic acid;sulfane |
| SMILES | O=C(O)CCC(=O)CC(=O)O.S |
| InChI | InChI=1S/C6H8O5.H2S/c7-4(3-6(10)11)1-2-5(8)9;/h1-3H2,(H,8,9)(H,10,11);1H2 |
| InChIKey | YZRAPDMLEUXKIV-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.21 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-oxohexanedioic acid;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxohexanedioic acid;sulfane?
The IUPAC name of 3-oxohexanedioic acid;sulfane (CID 174916165) is 3-oxohexanedioic acid;sulfane.
What is the SMILES notation for 3-oxohexanedioic acid;sulfane?
The canonical SMILES for 3-oxohexanedioic acid;sulfane is O=C(O)CCC(=O)CC(=O)O.S.
What is the InChIKey of 3-oxohexanedioic acid;sulfane?
The InChIKey is YZRAPDMLEUXKIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O5.H2S/c7-4(3-6(10)11)1-2-5(8)9;/h1-3H2,(H,8,9)(H,10,11);1H2.
What are the key properties of 3-oxohexanedioic acid;sulfane?
3-oxohexanedioic acid;sulfane has a molecular weight of 194.21 g/mol, XLogP of 0.01, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxohexanedioic acid;sulfane is sourced from PubChem (CID 174916165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).