About butanedioic acid;hydrochloride
butanedioic acid;hydrochloride (PubChem CID 87113713) has the molecular formula C4H7ClO4
and a molecular weight of 154.55 g/mol. Its IUPAC name is butanedioic acid;hydrochloride.
Molecular Properties
| Compound Name | butanedioic acid;hydrochloride |
| PubChem CID | 87113713 |
| Molecular Formula | C4H7ClO4 |
| Molecular Weight | 154.55 g/mol |
| Exact Mass | 154.00 |
| IUPAC Name | butanedioic acid;hydrochloride |
| SMILES | Cl.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C4H6O4.ClH/c5-3(6)1-2-4(7)8;/h1-2H2,(H,5,6)(H,7,8);1H |
| InChIKey | PQRJKIYUDHXGLQ-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.55 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze butanedioic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanedioic acid;hydrochloride?
The IUPAC name of butanedioic acid;hydrochloride (CID 87113713) is butanedioic acid;hydrochloride.
What is the SMILES notation for butanedioic acid;hydrochloride?
The canonical SMILES for butanedioic acid;hydrochloride is Cl.O=C(O)CCC(=O)O.
What is the InChIKey of butanedioic acid;hydrochloride?
The InChIKey is PQRJKIYUDHXGLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O4.ClH/c5-3(6)1-2-4(7)8;/h1-2H2,(H,5,6)(H,7,8);1H.
What are the key properties of butanedioic acid;hydrochloride?
butanedioic acid;hydrochloride has a molecular weight of 154.55 g/mol, XLogP of 0.36, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butanedioic acid;hydrochloride is sourced from PubChem (CID 87113713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).