About bis(butanedioic acid);hydroxylamine
bis(butanedioic acid);hydroxylamine (PubChem CID 174855273) has the molecular formula C8H15NO9
and a molecular weight of 269.21 g/mol. Its IUPAC name is bis(butanedioic acid);hydroxylamine.
Molecular Properties
| Compound Name | bis(butanedioic acid);hydroxylamine |
| PubChem CID | 174855273 |
| Molecular Formula | C8H15NO9 |
| Molecular Weight | 269.21 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | bis(butanedioic acid);hydroxylamine |
| SMILES | NO.O=C(O)CCC(=O)O.O=C(O)CCC(=O)O |
| InChI | InChI=1S/2C4H6O4.H3NO/c2*5-3(6)1-2-4(7)8;1-2/h2*1-2H2,(H,5,6)(H,7,8);2H,1H2 |
| InChIKey | URQHQZSXXLAJAX-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 195.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 269.21 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze bis(butanedioic acid);hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(butanedioic acid);hydroxylamine?
The IUPAC name of bis(butanedioic acid);hydroxylamine (CID 174855273) is bis(butanedioic acid);hydroxylamine.
What is the SMILES notation for bis(butanedioic acid);hydroxylamine?
The canonical SMILES for bis(butanedioic acid);hydroxylamine is NO.O=C(O)CCC(=O)O.O=C(O)CCC(=O)O.
What is the InChIKey of bis(butanedioic acid);hydroxylamine?
The InChIKey is URQHQZSXXLAJAX-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H6O4.H3NO/c2*5-3(6)1-2-4(7)8;1-2/h2*1-2H2,(H,5,6)(H,7,8);2H,1H2.
What are the key properties of bis(butanedioic acid);hydroxylamine?
bis(butanedioic acid);hydroxylamine has a molecular weight of 269.21 g/mol, XLogP of -0.79, 6 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(butanedioic acid);hydroxylamine is sourced from PubChem (CID 174855273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).