About bis(butanedioic acid);carbonic acid
bis(butanedioic acid);carbonic acid (PubChem CID 159577506) has the molecular formula C9H14O11
and a molecular weight of 298.20 g/mol. Its IUPAC name is bis(butanedioic acid);carbonic acid.
Molecular Properties
| Compound Name | bis(butanedioic acid);carbonic acid |
| PubChem CID | 159577506 |
| Molecular Formula | C9H14O11 |
| Molecular Weight | 298.20 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | bis(butanedioic acid);carbonic acid |
| SMILES | O=C(O)CCC(=O)O.O=C(O)CCC(=O)O.O=C(O)O |
| InChI | InChI=1S/2C4H6O4.CH2O3/c2*5-3(6)1-2-4(7)8;2-1(3)4/h2*1-2H2,(H,5,6)(H,7,8);(H2,2,3,4) |
| InChIKey | MIPAOONFKSZNDF-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 206.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.20 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze bis(butanedioic acid);carbonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(butanedioic acid);carbonic acid?
The IUPAC name of bis(butanedioic acid);carbonic acid (CID 159577506) is bis(butanedioic acid);carbonic acid.
What is the SMILES notation for bis(butanedioic acid);carbonic acid?
The canonical SMILES for bis(butanedioic acid);carbonic acid is O=C(O)CCC(=O)O.O=C(O)CCC(=O)O.O=C(O)O.
What is the InChIKey of bis(butanedioic acid);carbonic acid?
The InChIKey is MIPAOONFKSZNDF-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H6O4.CH2O3/c2*5-3(6)1-2-4(7)8;2-1(3)4/h2*1-2H2,(H,5,6)(H,7,8);(H2,2,3,4).
What are the key properties of bis(butanedioic acid);carbonic acid?
bis(butanedioic acid);carbonic acid has a molecular weight of 298.20 g/mol, XLogP of 0.09, 6 rotatable bonds, 6 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(butanedioic acid);carbonic acid is sourced from PubChem (CID 159577506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).