C6H11NO5 — CID 140898844
azanium 6-hydroxy-3,6-dioxohexanoate (PubChem CID 140898844) has the molecular formula C6H11NO5 and a molecular weight of 177.16 g/mol. Its IUPAC name is azanium 6-hydroxy-3,6-dioxohexanoate.
| Compound Name | azanium 6-hydroxy-3,6-dioxohexanoate |
|---|---|
| PubChem CID | 140898844 |
| Molecular Formula | C6H11NO5 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | azanium 6-hydroxy-3,6-dioxohexanoate |
| SMILES | O=C([O-])CC(=O)CCC(=O)O.[NH4+] |
| InChI | InChI=1S/C6H8O5.H3N/c7-4(3-6(10)11)1-2-5(8)9;/h1-3H2,(H,8,9)(H,10,11);1H3 |
| InChIKey | BDMUORSAPJSHPE-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 131.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|