C10H14Na2O8 — CID 163708561
disodium;butanedioic acid;hexanedioate (PubChem CID 163708561) has the molecular formula C10H14Na2O8 and a molecular weight of 308.19 g/mol. Its IUPAC name is disodium;butanedioic acid;hexanedioate.
| Compound Name | disodium;butanedioic acid;hexanedioate |
|---|---|
| PubChem CID | 163708561 |
| Molecular Formula | C10H14Na2O8 |
| Molecular Weight | 308.19 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | disodium;butanedioic acid;hexanedioate |
| SMILES | O=C(O)CCC(=O)O.O=C([O-])CCCCC(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C6H10O4.C4H6O4.2Na/c7-5(8)3-1-2-4-6(9)10;5-3(6)1-2-4(7)8;;/h1-4H2,(H,7,8)(H,9,10);1-2H2,(H,5,6)(H,7,8);;/q;;2*+1/p-2 |
| InChIKey | KHEUKVGWHODPQL-UHFFFAOYSA-L |
| XLogP | -8.01 |
| TPSA | 154.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.19 |
| LogP ≤ 5 | -8.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|