C10H15LiO8 — CID 175049997
lithium;butanedioic acid;6-hydroxy-6-oxohexanoate (PubChem CID 175049997) has the molecular formula C10H15LiO8 and a molecular weight of 270.16 g/mol. Its IUPAC name is lithium;butanedioic acid;6-hydroxy-6-oxohexanoate.
| Compound Name | lithium;butanedioic acid;6-hydroxy-6-oxohexanoate |
|---|---|
| PubChem CID | 175049997 |
| Molecular Formula | C10H15LiO8 |
| Molecular Weight | 270.16 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | lithium;butanedioic acid;6-hydroxy-6-oxohexanoate |
| SMILES | O=C(O)CCC(=O)O.O=C([O-])CCCCC(=O)O.[Li+] |
| InChI | InChI=1S/C6H10O4.C4H6O4.Li/c7-5(8)3-1-2-4-6(9)10;5-3(6)1-2-4(7)8;/h1-4H2,(H,7,8)(H,9,10);1-2H2,(H,5,6)(H,7,8);/q;;+1/p-1 |
| InChIKey | NVQBFHMXASZAMF-UHFFFAOYSA-M |
| XLogP | -3.68 |
| TPSA | 152.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.16 |
| LogP ≤ 5 | -3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|