About lithium;6-hydroxy-6-oxohexanoate;prop-2-enamide
lithium;6-hydroxy-6-oxohexanoate;prop-2-enamide (PubChem CID 175027338) has the molecular formula C9H14LiNO5
and a molecular weight of 223.15 g/mol. Its IUPAC name is lithium;6-hydroxy-6-oxohexanoate;prop-2-enamide.
Molecular Properties
| Compound Name | lithium;6-hydroxy-6-oxohexanoate;prop-2-enamide |
| PubChem CID | 175027338 |
| Molecular Formula | C9H14LiNO5 |
| Molecular Weight | 223.15 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | lithium;6-hydroxy-6-oxohexanoate;prop-2-enamide |
| SMILES | C=CC(N)=O.O=C([O-])CCCCC(=O)O.[Li+] |
| InChI | InChI=1S/C6H10O4.C3H5NO.Li/c7-5(8)3-1-2-4-6(9)10;1-2-3(4)5;/h1-4H2,(H,7,8)(H,9,10);2H,1H2,(H2,4,5);/q;;+1/p-1 |
| InChIKey | DNFPMMLIMIWFRG-UHFFFAOYSA-M |
| XLogP | -3.96 |
| TPSA | 120.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.15 |
| LogP ≤ 5 | -3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze lithium;6-hydroxy-6-oxohexanoate;prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;6-hydroxy-6-oxohexanoate;prop-2-enamide?
The IUPAC name of lithium;6-hydroxy-6-oxohexanoate;prop-2-enamide (CID 175027338) is lithium;6-hydroxy-6-oxohexanoate;prop-2-enamide.
What is the SMILES notation for lithium;6-hydroxy-6-oxohexanoate;prop-2-enamide?
The canonical SMILES for lithium;6-hydroxy-6-oxohexanoate;prop-2-enamide is C=CC(N)=O.O=C([O-])CCCCC(=O)O.[Li+].
What is the InChIKey of lithium;6-hydroxy-6-oxohexanoate;prop-2-enamide?
The InChIKey is DNFPMMLIMIWFRG-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H10O4.C3H5NO.Li/c7-5(8)3-1-2-4-6(9)10;1-2-3(4)5;/h1-4H2,(H,7,8)(H,9,10);2H,1H2,(H2,4,5);/q;;+1/p-1.
What are the key properties of lithium;6-hydroxy-6-oxohexanoate;prop-2-enamide?
lithium;6-hydroxy-6-oxohexanoate;prop-2-enamide has a molecular weight of 223.15 g/mol, XLogP of -3.96, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;6-hydroxy-6-oxohexanoate;prop-2-enamide is sourced from PubChem (CID 175027338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).