About calcium;decanedioate;prop-2-enoic acid
calcium;decanedioate;prop-2-enoic acid (PubChem CID 157321777) has the molecular formula C13H20CaO6
and a molecular weight of 312.38 g/mol. Its IUPAC name is calcium;decanedioate;prop-2-enoic acid.
Molecular Properties
| Compound Name | calcium;decanedioate;prop-2-enoic acid |
| PubChem CID | 157321777 |
| Molecular Formula | C13H20CaO6 |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | calcium;decanedioate;prop-2-enoic acid |
| SMILES | C=CC(=O)O.O=C([O-])CCCCCCCCC(=O)[O-].[Ca+2] |
| InChI | InChI=1S/C10H18O4.C3H4O2.Ca/c11-9(12)7-5-3-1-2-4-6-8-10(13)14;1-2-3(4)5;/h1-8H2,(H,11,12)(H,13,14);2H,1H2,(H,4,5);/q;;+2/p-2 |
| InChIKey | NOCATARGVDQCDI-UHFFFAOYSA-L |
| XLogP | -0.52 |
| TPSA | 117.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze calcium;decanedioate;prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;decanedioate;prop-2-enoic acid?
The IUPAC name of calcium;decanedioate;prop-2-enoic acid (CID 157321777) is calcium;decanedioate;prop-2-enoic acid.
What is the SMILES notation for calcium;decanedioate;prop-2-enoic acid?
The canonical SMILES for calcium;decanedioate;prop-2-enoic acid is C=CC(=O)O.O=C([O-])CCCCCCCCC(=O)[O-].[Ca+2].
What is the InChIKey of calcium;decanedioate;prop-2-enoic acid?
The InChIKey is NOCATARGVDQCDI-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H18O4.C3H4O2.Ca/c11-9(12)7-5-3-1-2-4-6-8-10(13)14;1-2-3(4)5;/h1-8H2,(H,11,12)(H,13,14);2H,1H2,(H,4,5);/q;;+2/p-2.
What are the key properties of calcium;decanedioate;prop-2-enoic acid?
calcium;decanedioate;prop-2-enoic acid has a molecular weight of 312.38 g/mol, XLogP of -0.52, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;decanedioate;prop-2-enoic acid is sourced from PubChem (CID 157321777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).