About calcium undec-10-enoate
calcium undec-10-enoate (PubChem CID 23617473) has the molecular formula C11H19CaO2+
and a molecular weight of 223.35 g/mol. Its IUPAC name is calcium undec-10-enoate.
Molecular Properties
| Compound Name | calcium undec-10-enoate |
| PubChem CID | 23617473 |
| Molecular Formula | C11H19CaO2+ |
| Molecular Weight | 223.35 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | calcium undec-10-enoate |
| SMILES | C=CCCCCCCCCC(=O)[O-].[Ca+2] |
| InChI | InChI=1S/C11H20O2.Ca/c1-2-3-4-5-6-7-8-9-10-11(12)13;/h2H,1,3-10H2,(H,12,13);/q;+2/p-1 |
| InChIKey | MBVZFDMYDDNIBN-UHFFFAOYSA-M |
| XLogP | 1.66 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.35 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze calcium undec-10-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium undec-10-enoate?
The IUPAC name of calcium undec-10-enoate (CID 23617473) is calcium undec-10-enoate.
What is the SMILES notation for calcium undec-10-enoate?
The canonical SMILES for calcium undec-10-enoate is C=CCCCCCCCCC(=O)[O-].[Ca+2].
What is the InChIKey of calcium undec-10-enoate?
The InChIKey is MBVZFDMYDDNIBN-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H20O2.Ca/c1-2-3-4-5-6-7-8-9-10-11(12)13;/h2H,1,3-10H2,(H,12,13);/q;+2/p-1.
What are the key properties of calcium undec-10-enoate?
calcium undec-10-enoate has a molecular weight of 223.35 g/mol, XLogP of 1.66, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for calcium undec-10-enoate is sourced from PubChem (CID 23617473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).