About iron(2+);bis(undec-10-enoate)
iron(2+);bis(undec-10-enoate) (PubChem CID 89315244) has the molecular formula C22H38FeO4
and a molecular weight of 422.39 g/mol. Its IUPAC name is iron(2+);bis(undec-10-enoate).
Molecular Properties
| Compound Name | iron(2+);bis(undec-10-enoate) |
| PubChem CID | 89315244 |
| Molecular Formula | C22H38FeO4 |
| Molecular Weight | 422.39 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | iron(2+);bis(undec-10-enoate) |
| SMILES | C=CCCCCCCCCC(=O)[O-].C=CCCCCCCCCC(=O)[O-].[Fe+2] |
| InChI | InChI=1S/2C11H20O2.Fe/c2*1-2-3-4-5-6-7-8-9-10-11(12)13;/h2*2H,1,3-10H2,(H,12,13);/q;;+2/p-2 |
| InChIKey | GDTUKPPWQPWALU-UHFFFAOYSA-L |
| XLogP | 4.08 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.39 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze iron(2+);bis(undec-10-enoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iron(2+);bis(undec-10-enoate)?
The IUPAC name of iron(2+);bis(undec-10-enoate) (CID 89315244) is iron(2+);bis(undec-10-enoate).
What is the SMILES notation for iron(2+);bis(undec-10-enoate)?
The canonical SMILES for iron(2+);bis(undec-10-enoate) is C=CCCCCCCCCC(=O)[O-].C=CCCCCCCCCC(=O)[O-].[Fe+2].
What is the InChIKey of iron(2+);bis(undec-10-enoate)?
The InChIKey is GDTUKPPWQPWALU-UHFFFAOYSA-L. The full InChI is InChI=1S/2C11H20O2.Fe/c2*1-2-3-4-5-6-7-8-9-10-11(12)13;/h2*2H,1,3-10H2,(H,12,13);/q;;+2/p-2.
What are the key properties of iron(2+);bis(undec-10-enoate)?
iron(2+);bis(undec-10-enoate) has a molecular weight of 422.39 g/mol, XLogP of 4.08, 18 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for iron(2+);bis(undec-10-enoate) is sourced from PubChem (CID 89315244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).