About diethylalumanylium;undec-10-enoate
diethylalumanylium;undec-10-enoate (PubChem CID 21401828) has the molecular formula C15H29AlO2
and a molecular weight of 268.38 g/mol. Its IUPAC name is diethylalumanylium;undec-10-enoate.
Molecular Properties
| Compound Name | diethylalumanylium;undec-10-enoate |
| PubChem CID | 21401828 |
| Molecular Formula | C15H29AlO2 |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | diethylalumanylium;undec-10-enoate |
| SMILES | C=CCCCCCCCCC(=O)[O-].CC[Al+]CC |
| InChI | InChI=1S/C11H20O2.2C2H5.Al/c1-2-3-4-5-6-7-8-9-10-11(12)13;2*1-2;/h2H,1,3-10H2,(H,12,13);2*1H2,2H3;/q;;;+1/p-1 |
| InChIKey | ODPCEMIKPKAYHJ-UHFFFAOYSA-M |
| XLogP | 3.61 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze diethylalumanylium;undec-10-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethylalumanylium;undec-10-enoate?
The IUPAC name of diethylalumanylium;undec-10-enoate (CID 21401828) is diethylalumanylium;undec-10-enoate.
What is the SMILES notation for diethylalumanylium;undec-10-enoate?
The canonical SMILES for diethylalumanylium;undec-10-enoate is C=CCCCCCCCCC(=O)[O-].CC[Al+]CC.
What is the InChIKey of diethylalumanylium;undec-10-enoate?
The InChIKey is ODPCEMIKPKAYHJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H20O2.2C2H5.Al/c1-2-3-4-5-6-7-8-9-10-11(12)13;2*1-2;/h2H,1,3-10H2,(H,12,13);2*1H2,2H3;/q;;;+1/p-1.
What are the key properties of diethylalumanylium;undec-10-enoate?
diethylalumanylium;undec-10-enoate has a molecular weight of 268.38 g/mol, XLogP of 3.61, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diethylalumanylium;undec-10-enoate is sourced from PubChem (CID 21401828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).